C12H8BrF3S — CID 103304188
3-[bromo-(2,4,5-trifluorophenyl)methyl]-4-methylthiophene (PubChem CID 103304188) has the molecular formula C12H8BrF3S and a molecular weight of 321.16 g/mol. Its IUPAC name is 3-[bromo-(2,4,5-trifluorophenyl)methyl]-4-methylthiophene.
| Compound Name | 3-[bromo-(2,4,5-trifluorophenyl)methyl]-4-methylthiophene |
|---|---|
| PubChem CID | 103304188 |
| Molecular Formula | C12H8BrF3S |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 3-[bromo-(2,4,5-trifluorophenyl)methyl]-4-methylthiophene |
| SMILES | Cc1cscc1C(Br)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H8BrF3S/c1-6-4-17-5-8(6)12(13)7-2-10(15)11(16)3-9(7)14/h2-5,12H,1H3 |
| InChIKey | IJWPDMMJOLCUGW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|