C14H12BrF3O — CID 103304126
3-[bromo-(2,4,5-trifluorophenyl)methyl]-2,4,5-trimethylfuran (PubChem CID 103304126) has the molecular formula C14H12BrF3O and a molecular weight of 333.15 g/mol. Its IUPAC name is 3-[bromo-(2,4,5-trifluorophenyl)methyl]-2,4,5-trimethylfuran.
| Compound Name | 3-[bromo-(2,4,5-trifluorophenyl)methyl]-2,4,5-trimethylfuran |
|---|---|
| PubChem CID | 103304126 |
| Molecular Formula | C14H12BrF3O |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 3-[bromo-(2,4,5-trifluorophenyl)methyl]-2,4,5-trimethylfuran |
| SMILES | Cc1oc(C)c(C(Br)c2cc(F)c(F)cc2F)c1C |
| InChI | InChI=1S/C14H12BrF3O/c1-6-7(2)19-8(3)13(6)14(15)9-4-11(17)12(18)5-10(9)16/h4-5,14H,1-3H3 |
| InChIKey | OAPCYUZVDCDLEK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|