C14H13F3O2 — CID 115796955
(2,3,4-trifluorophenyl)-(2,4,5-trimethylfuran-3-yl)methanol (PubChem CID 115796955) has the molecular formula C14H13F3O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is (2,3,4-trifluorophenyl)-(2,4,5-trimethylfuran-3-yl)methanol.
| Compound Name | (2,3,4-trifluorophenyl)-(2,4,5-trimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 115796955 |
| Molecular Formula | C14H13F3O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2,3,4-trifluorophenyl)-(2,4,5-trimethylfuran-3-yl)methanol |
| SMILES | Cc1oc(C)c(C(O)c2ccc(F)c(F)c2F)c1C |
| InChI | InChI=1S/C14H13F3O2/c1-6-7(2)19-8(3)11(6)14(18)9-4-5-10(15)13(17)12(9)16/h4-5,14,18H,1-3H3 |
| InChIKey | UYKDXDLUDLJYFB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|