C18H17FO2 — CID 65153464
(4-fluoronaphthalen-1-yl)-(2,4,5-trimethylfuran-3-yl)methanol (PubChem CID 65153464) has the molecular formula C18H17FO2 and a molecular weight of 284.33 g/mol. Its IUPAC name is (4-fluoronaphthalen-1-yl)-(2,4,5-trimethylfuran-3-yl)methanol.
| Compound Name | (4-fluoronaphthalen-1-yl)-(2,4,5-trimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 65153464 |
| Molecular Formula | C18H17FO2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (4-fluoronaphthalen-1-yl)-(2,4,5-trimethylfuran-3-yl)methanol |
| SMILES | Cc1oc(C)c(C(O)c2ccc(F)c3ccccc23)c1C |
| InChI | InChI=1S/C18H17FO2/c1-10-11(2)21-12(3)17(10)18(20)15-8-9-16(19)14-7-5-4-6-13(14)15/h4-9,18,20H,1-3H3 |
| InChIKey | DJDLSSMLRJQKNI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |