C17H17NO2 — CID 115826290
quinolin-5-yl-(2,4,5-trimethylfuran-3-yl)methanol (PubChem CID 115826290) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is quinolin-5-yl-(2,4,5-trimethylfuran-3-yl)methanol.
| Compound Name | quinolin-5-yl-(2,4,5-trimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 115826290 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | quinolin-5-yl-(2,4,5-trimethylfuran-3-yl)methanol |
| SMILES | Cc1oc(C)c(C(O)c2cccc3ncccc23)c1C |
| InChI | InChI=1S/C17H17NO2/c1-10-11(2)20-12(3)16(10)17(19)14-6-4-8-15-13(14)7-5-9-18-15/h4-9,17,19H,1-3H3 |
| InChIKey | CJOCXNFNXCAXPL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |