About 5-(1-iodoethyl)quinoline
5-(1-iodoethyl)quinoline (PubChem CID 130224458) has the molecular formula C11H10IN
and a molecular weight of 283.11 g/mol. Its IUPAC name is 5-(1-iodoethyl)quinoline.
Molecular Properties
| Compound Name | 5-(1-iodoethyl)quinoline |
| PubChem CID | 130224458 |
| Molecular Formula | C11H10IN |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 5-(1-iodoethyl)quinoline |
| SMILES | CC(I)c1cccc2ncccc12 |
| InChI | InChI=1S/C11H10IN/c1-8(12)9-4-2-6-11-10(9)5-3-7-13-11/h2-8H,1H3 |
| InChIKey | NJPCZQQRBXPVNU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-iodoethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-iodoethyl)quinoline?
The IUPAC name of 5-(1-iodoethyl)quinoline (CID 130224458) is 5-(1-iodoethyl)quinoline.
What is the SMILES notation for 5-(1-iodoethyl)quinoline?
The canonical SMILES for 5-(1-iodoethyl)quinoline is CC(I)c1cccc2ncccc12.
What is the InChIKey of 5-(1-iodoethyl)quinoline?
The InChIKey is NJPCZQQRBXPVNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10IN/c1-8(12)9-4-2-6-11-10(9)5-3-7-13-11/h2-8H,1H3.
What are the key properties of 5-(1-iodoethyl)quinoline?
5-(1-iodoethyl)quinoline has a molecular weight of 283.11 g/mol, XLogP of 3.73, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-iodoethyl)quinoline is sourced from PubChem (CID 130224458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).