C14H12N2OS — CID 113451230
(4-methyl-1,3-thiazol-2-yl)-quinolin-5-ylmethanol (PubChem CID 113451230) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)-quinolin-5-ylmethanol.
| Compound Name | (4-methyl-1,3-thiazol-2-yl)-quinolin-5-ylmethanol |
|---|---|
| PubChem CID | 113451230 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (4-methyl-1,3-thiazol-2-yl)-quinolin-5-ylmethanol |
| SMILES | Cc1csc(C(O)c2cccc3ncccc23)n1 |
| InChI | InChI=1S/C14H12N2OS/c1-9-8-18-14(16-9)13(17)11-4-2-6-12-10(11)5-3-7-15-12/h2-8,13,17H,1H3 |
| InChIKey | RXSLCFPBLTXNDI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |