About (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol
(2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol (PubChem CID 104769588) has the molecular formula C10H11N3OS
and a molecular weight of 221.29 g/mol. Its IUPAC name is (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol |
| PubChem CID | 104769588 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol |
| SMILES | Cc1csc(C(O)c2cccnc2N)n1 |
| InChI | InChI=1S/C10H11N3OS/c1-6-5-15-10(13-6)8(14)7-3-2-4-12-9(7)11/h2-5,8,14H,1H3,(H2,11,12) |
| InChIKey | PEOXKIRPDPSHRZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol?
The IUPAC name of (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol (CID 104769588) is (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol?
The canonical SMILES for (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol is Cc1csc(C(O)c2cccnc2N)n1.
What is the InChIKey of (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol?
The InChIKey is PEOXKIRPDPSHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-6-5-15-10(13-6)8(14)7-3-2-4-12-9(7)11/h2-5,8,14H,1H3,(H2,11,12).
What are the key properties of (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol?
(2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol has a molecular weight of 221.29 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 104769588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).