C10H11N3OS — CID 104769588
(2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol (PubChem CID 104769588) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol.
| Compound Name | (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 104769588 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (2-amino-3-pyridinyl)-(4-methyl-1,3-thiazol-2-yl)methanol |
| SMILES | Cc1csc(C(O)c2cccnc2N)n1 |
| InChI | InChI=1S/C10H11N3OS/c1-6-5-15-10(13-6)8(14)7-3-2-4-12-9(7)11/h2-5,8,14H,1H3,(H2,11,12) |
| InChIKey | PEOXKIRPDPSHRZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |