About furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol
furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol (PubChem CID 104769449) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol |
| PubChem CID | 104769449 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol |
| SMILES | Cc1csc(C(O)c2ccco2)n1 |
| InChI | InChI=1S/C9H9NO2S/c1-6-5-13-9(10-6)8(11)7-3-2-4-12-7/h2-5,8,11H,1H3 |
| InChIKey | JIPCPDBRXQYDKK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol?
The IUPAC name of furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol (CID 104769449) is furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol?
The canonical SMILES for furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol is Cc1csc(C(O)c2ccco2)n1.
What is the InChIKey of furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol?
The InChIKey is JIPCPDBRXQYDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c1-6-5-13-9(10-6)8(11)7-3-2-4-12-7/h2-5,8,11H,1H3.
What are the key properties of furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol?
furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol has a molecular weight of 195.24 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-yl-(4-methyl-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 104769449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).