3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid

C11H11NO3S — CID 82026638

IUPAC3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid
SMILESCc1csc(C(CC(=O)O)c2ccco2)n1
InChIInChI=1S/C11H11NO3S/c1-7-6-16-11(12-7)8(5-10(13)14)9-3-2-4-15-9/h2-4,6,8H,5H2,1H3,(H,13,14)
InChIKeyKGZGPVBISZCSOC-UHFFFAOYSA-N
MW237.28 g/mol
LogP2.65
Rot. Bonds4

About 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid

3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid (PubChem CID 82026638) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid
PubChem CID82026638
Molecular FormulaC11H11NO3S
Molecular Weight237.28 g/mol
Exact Mass237.05
IUPAC Name3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid
SMILESCc1csc(C(CC(=O)O)c2ccco2)n1
InChIInChI=1S/C11H11NO3S/c1-7-6-16-11(12-7)8(5-10(13)14)9-3-2-4-15-9/h2-4,6,8H,5H2,1H3,(H,13,14)
InChIKeyKGZGPVBISZCSOC-UHFFFAOYSA-N
XLogP2.65
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.28
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid (CID 82026638) is 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid is Cc1csc(C(CC(=O)O)c2ccco2)n1.
What is the InChIKey of 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid?
The InChIKey is KGZGPVBISZCSOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c1-7-6-16-11(12-7)8(5-10(13)14)9-3-2-4-15-9/h2-4,6,8H,5H2,1H3,(H,13,14).
What are the key properties of 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid?
3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid has a molecular weight of 237.28 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-3-(4-methyl-1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 82026638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).