About 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal
3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal (PubChem CID 82040279) has the molecular formula C11H11NO2S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal |
| PubChem CID | 82040279 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal |
| SMILES | Cc1csc(C(C=O)Cc2ccco2)n1 |
| InChI | InChI=1S/C11H11NO2S/c1-8-7-15-11(12-8)9(6-13)5-10-3-2-4-14-10/h2-4,6-7,9H,5H2,1H3 |
| InChIKey | VOMQUGUJUPTEDG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal?
The IUPAC name of 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal (CID 82040279) is 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal.
What is the SMILES notation for 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal?
The canonical SMILES for 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal is Cc1csc(C(C=O)Cc2ccco2)n1.
What is the InChIKey of 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal?
The InChIKey is VOMQUGUJUPTEDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S/c1-8-7-15-11(12-8)9(6-13)5-10-3-2-4-14-10/h2-4,6-7,9H,5H2,1H3.
What are the key properties of 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal?
3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal has a molecular weight of 221.28 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal is sourced from PubChem (CID 82040279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).