C11H11NO2S — CID 82040279
3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal (PubChem CID 82040279) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal.
| Compound Name | 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal |
|---|---|
| PubChem CID | 82040279 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 3-(furan-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)propanal |
| SMILES | Cc1csc(C(C=O)Cc2ccco2)n1 |
| InChI | InChI=1S/C11H11NO2S/c1-8-7-15-11(12-8)9(6-13)5-10-3-2-4-14-10/h2-4,6-7,9H,5H2,1H3 |
| InChIKey | VOMQUGUJUPTEDG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|