C6H6ClNOS — CID 87686562
2-chloro-2-(4-methyl-1,3-thiazol-2-yl)acetaldehyde (PubChem CID 87686562) has the molecular formula C6H6ClNOS and a molecular weight of 175.64 g/mol. Its IUPAC name is 2-chloro-2-(4-methyl-1,3-thiazol-2-yl)acetaldehyde.
| Compound Name | 2-chloro-2-(4-methyl-1,3-thiazol-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 87686562 |
| Molecular Formula | C6H6ClNOS |
| Molecular Weight | 175.64 g/mol |
| Exact Mass | 174.99 |
| IUPAC Name | 2-chloro-2-(4-methyl-1,3-thiazol-2-yl)acetaldehyde |
| SMILES | Cc1csc(C(Cl)C=O)n1 |
| InChI | InChI=1S/C6H6ClNOS/c1-4-3-10-6(8-4)5(7)2-9/h2-3,5H,1H3 |
| InChIKey | AQELZCNIEKTXRY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.64 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|