2-(4-methyl-1,3-thiazol-2-yl)butanoic acid

C8H11NO2S — CID 66752054

IUPAC2-(4-methyl-1,3-thiazol-2-yl)butanoic acid
SMILESCCC(C(=O)O)c1nc(C)cs1
InChIInChI=1S/C8H11NO2S/c1-3-6(8(10)11)7-9-5(2)4-12-7/h4,6H,3H2,1-2H3,(H,10,11)
InChIKeyLKDXPWCBXITIAG-UHFFFAOYSA-N
MW185.25 g/mol
LogP2.03
Rot. Bonds3

About 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid

2-(4-methyl-1,3-thiazol-2-yl)butanoic acid (PubChem CID 66752054) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid.

Molecular Properties

Compound Name2-(4-methyl-1,3-thiazol-2-yl)butanoic acid
PubChem CID66752054
Molecular FormulaC8H11NO2S
Molecular Weight185.25 g/mol
Exact Mass185.05
IUPAC Name2-(4-methyl-1,3-thiazol-2-yl)butanoic acid
SMILESCCC(C(=O)O)c1nc(C)cs1
InChIInChI=1S/C8H11NO2S/c1-3-6(8(10)11)7-9-5(2)4-12-7/h4,6H,3H2,1-2H3,(H,10,11)
InChIKeyLKDXPWCBXITIAG-UHFFFAOYSA-N
XLogP2.03
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.25
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid?
The IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid (CID 66752054) is 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid is CCC(C(=O)O)c1nc(C)cs1.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid?
The InChIKey is LKDXPWCBXITIAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-3-6(8(10)11)7-9-5(2)4-12-7/h4,6H,3H2,1-2H3,(H,10,11).
What are the key properties of 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid?
2-(4-methyl-1,3-thiazol-2-yl)butanoic acid has a molecular weight of 185.25 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-2-yl)butanoic acid is sourced from PubChem (CID 66752054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).