(2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid

C8H12N2O2S — CID 93057158

IUPAC(2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid
SMILESCC[C@H](Nc1nc(C)cs1)C(=O)O
InChIInChI=1S/C8H12N2O2S/c1-3-6(7(11)12)10-8-9-5(2)4-13-8/h4,6H,3H2,1-2H3,(H,9,10)(H,11,12)/t6-/m0/s1
InChIKeyJTJBEQLJFXCUQT-LURJTMIESA-N
MW200.26 g/mol
LogP1.73
Rot. Bonds4

About (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid

(2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid (PubChem CID 93057158) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid.

Molecular Properties

Compound Name(2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid
PubChem CID93057158
Molecular FormulaC8H12N2O2S
Molecular Weight200.26 g/mol
Exact Mass200.06
IUPAC Name(2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid
SMILESCC[C@H](Nc1nc(C)cs1)C(=O)O
InChIInChI=1S/C8H12N2O2S/c1-3-6(7(11)12)10-8-9-5(2)4-13-8/h4,6H,3H2,1-2H3,(H,9,10)(H,11,12)/t6-/m0/s1
InChIKeyJTJBEQLJFXCUQT-LURJTMIESA-N
XLogP1.73
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.26
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid?
The IUPAC name of (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid (CID 93057158) is (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid.
What is the SMILES notation for (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid?
The canonical SMILES for (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid is CC[C@H](Nc1nc(C)cs1)C(=O)O.
What is the InChIKey of (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid?
The InChIKey is JTJBEQLJFXCUQT-LURJTMIESA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-3-6(7(11)12)10-8-9-5(2)4-13-8/h4,6H,3H2,1-2H3,(H,9,10)(H,11,12)/t6-/m0/s1.
What are the key properties of (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid?
(2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid has a molecular weight of 200.26 g/mol, XLogP of 1.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(4-methyl-1,3-thiazol-2-yl)amino]butanoic acid is sourced from PubChem (CID 93057158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).