C7H12N2S — CID 841733
4-methyl-N-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 841733) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 4-methyl-N-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 841733 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 4-methyl-N-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NC(C)C)n1 |
| InChI | InChI=1S/C7H12N2S/c1-5(2)8-7-9-6(3)4-10-7/h4-5H,1-3H3,(H,8,9) |
| InChIKey | ZSMPXLJQCKPGFF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |