C7H11ClN2S — CID 65027979
N-(2-chloropropyl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 65027979) has the molecular formula C7H11ClN2S and a molecular weight of 190.70 g/mol. Its IUPAC name is N-(2-chloropropyl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-(2-chloropropyl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 65027979 |
| Molecular Formula | C7H11ClN2S |
| Molecular Weight | 190.70 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | N-(2-chloropropyl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NCC(C)Cl)n1 |
| InChI | InChI=1S/C7H11ClN2S/c1-5(8)3-9-7-10-6(2)4-11-7/h4-5H,3H2,1-2H3,(H,9,10) |
| InChIKey | HKJCDQBMJHROFE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|