C12H22N2S — CID 107816461
N-(2-ethylhexyl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 107816461) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-(2-ethylhexyl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107816461 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-(2-ethylhexyl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCC(CC)CNc1nc(C)cs1 |
| InChI | InChI=1S/C12H22N2S/c1-4-6-7-11(5-2)8-13-12-14-10(3)9-15-12/h9,11H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | WAOOWXIYTYPVJW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |