C16H28N2O2S — CID 107818852
ethyl 3-[2-(2-ethylhexylamino)-1,3-thiazol-4-yl]propanoate (PubChem CID 107818852) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is ethyl 3-[2-(2-ethylhexylamino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(2-ethylhexylamino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 107818852 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | ethyl 3-[2-(2-ethylhexylamino)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCCCC(CC)CNc1nc(CCC(=O)OCC)cs1 |
| InChI | InChI=1S/C16H28N2O2S/c1-4-7-8-13(5-2)11-17-16-18-14(12-21-16)9-10-15(19)20-6-3/h12-13H,4-11H2,1-3H3,(H,17,18) |
| InChIKey | JUWYEFQPOXEWOU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |