C16H20N2O2S — CID 103486000
ethyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate (PubChem CID 103486000) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is ethyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103486000 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1csc(Nc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C16H20N2O2S/c1-4-20-15(19)6-5-13-10-21-16(17-13)18-14-8-11(2)7-12(3)9-14/h7-10H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | CLSZYWUDCKTRLU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |