C15H18N2O3S — CID 103486018
ethyl 3-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]propanoate (PubChem CID 103486018) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 3-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103486018 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 3-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1csc(Nc2cccc(OC)c2)n1 |
| InChI | InChI=1S/C15H18N2O3S/c1-3-20-14(18)8-7-12-10-21-15(17-12)16-11-5-4-6-13(9-11)19-2/h4-6,9-10H,3,7-8H2,1-2H3,(H,16,17) |
| InChIKey | CCFXBAFOYHXGDQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |