C14H14ClFN2O2S — CID 103486036
ethyl 3-[2-(3-chloro-2-fluoroanilino)-1,3-thiazol-4-yl]propanoate (PubChem CID 103486036) has the molecular formula C14H14ClFN2O2S and a molecular weight of 328.80 g/mol. Its IUPAC name is ethyl 3-[2-(3-chloro-2-fluoroanilino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(3-chloro-2-fluoroanilino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103486036 |
| Molecular Formula | C14H14ClFN2O2S |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | ethyl 3-[2-(3-chloro-2-fluoroanilino)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1csc(Nc2cccc(Cl)c2F)n1 |
| InChI | InChI=1S/C14H14ClFN2O2S/c1-2-20-12(19)7-6-9-8-21-14(17-9)18-11-5-3-4-10(15)13(11)16/h3-5,8H,2,6-7H2,1H3,(H,17,18) |
| InChIKey | FHWYSNVJCOZJKO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |