C15H16ClNO2S — CID 103485381
ethyl 3-[2-[(2-chlorophenyl)methyl]-1,3-thiazol-4-yl]propanoate (PubChem CID 103485381) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is ethyl 3-[2-[(2-chlorophenyl)methyl]-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-[(2-chlorophenyl)methyl]-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103485381 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | ethyl 3-[2-[(2-chlorophenyl)methyl]-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1csc(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H16ClNO2S/c1-2-19-15(18)8-7-12-10-20-14(17-12)9-11-5-3-4-6-13(11)16/h3-6,10H,2,7-9H2,1H3 |
| InChIKey | PVBPMBABTFOXEN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |