C12H13NO2S2 — CID 80574337
ethyl 2-[2-(thiophen-2-ylmethyl)-1,3-thiazol-4-yl]acetate (PubChem CID 80574337) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is ethyl 2-[2-(thiophen-2-ylmethyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(thiophen-2-ylmethyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80574337 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | ethyl 2-[2-(thiophen-2-ylmethyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(Cc2cccs2)n1 |
| InChI | InChI=1S/C12H13NO2S2/c1-2-15-12(14)6-9-8-17-11(13-9)7-10-4-3-5-16-10/h3-5,8H,2,6-7H2,1H3 |
| InChIKey | DQHUFNBMTAWEBE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |