C11H18N2O2S — CID 107380238
ethyl 2-[2-(4-aminobutyl)-1,3-thiazol-4-yl]acetate (PubChem CID 107380238) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is ethyl 2-[2-(4-aminobutyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(4-aminobutyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 107380238 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | ethyl 2-[2-(4-aminobutyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(CCCCN)n1 |
| InChI | InChI=1S/C11H18N2O2S/c1-2-15-11(14)7-9-8-16-10(13-9)5-3-4-6-12/h8H,2-7,12H2,1H3 |
| InChIKey | GAMZQTVWKHMHFR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|