C15H27N5OS — CID 110450519
2-[2-(5-aminopentyl)-1,3-thiazol-4-yl]-N-(4-methylpiperazin-1-yl)acetamide (PubChem CID 110450519) has the molecular formula C15H27N5OS and a molecular weight of 325.48 g/mol. Its IUPAC name is 2-[2-(5-aminopentyl)-1,3-thiazol-4-yl]-N-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | 2-[2-(5-aminopentyl)-1,3-thiazol-4-yl]-N-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 110450519 |
| Molecular Formula | C15H27N5OS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-[2-(5-aminopentyl)-1,3-thiazol-4-yl]-N-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(NC(=O)Cc2csc(CCCCCN)n2)CC1 |
| InChI | InChI=1S/C15H27N5OS/c1-19-7-9-20(10-8-19)18-14(21)11-13-12-22-15(17-13)5-3-2-4-6-16/h12H,2-11,16H2,1H3,(H,18,21) |
| InChIKey | CMAJWPSCCFIVRI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|