C10H17N3OS — CID 82547698
2-[2-(5-aminopentyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 82547698) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-[2-(5-aminopentyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | 2-[2-(5-aminopentyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 82547698 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-[2-(5-aminopentyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | NCCCCCc1nc(CC(N)=O)cs1 |
| InChI | InChI=1S/C10H17N3OS/c11-5-3-1-2-4-10-13-8(7-15-10)6-9(12)14/h7H,1-6,11H2,(H2,12,14) |
| InChIKey | YGJBKQXLUZHYAG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|