C7H10N2OS — CID 116970126
2-(4-ethyl-1,3-thiazol-2-yl)acetamide (PubChem CID 116970126) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-(4-ethyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-ethyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 116970126 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-(4-ethyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCc1csc(CC(N)=O)n1 |
| InChI | InChI=1S/C7H10N2OS/c1-2-5-4-11-7(9-5)3-6(8)10/h4H,2-3H2,1H3,(H2,8,10) |
| InChIKey | QDZREJGVDRMGRY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |