C8H11NO2S — CID 39237748
3-(4-ethyl-1,3-thiazol-2-yl)propanoic acid (PubChem CID 39237748) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-(4-ethyl-1,3-thiazol-2-yl)propanoic acid.
| Compound Name | 3-(4-ethyl-1,3-thiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 39237748 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 3-(4-ethyl-1,3-thiazol-2-yl)propanoic acid |
| SMILES | CCc1csc(CCC(=O)O)n1 |
| InChI | InChI=1S/C8H11NO2S/c1-2-6-5-12-7(9-6)3-4-8(10)11/h5H,2-4H2,1H3,(H,10,11) |
| InChIKey | VONALYBOGSBLMW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |