2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid

C9H14N2O2S — CID 94256908

IUPAC2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid
SMILESCCNCCc1nc(CC(=O)O)cs1
InChIInChI=1S/C9H14N2O2S/c1-2-10-4-3-8-11-7(6-14-8)5-9(12)13/h6,10H,2-5H2,1H3,(H,12,13)
InChIKeyKEICHGZQNYTVFL-UHFFFAOYSA-N
MW214.29 g/mol
LogP0.92
Rot. Bonds6

About 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid

2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 94256908) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid
PubChem CID94256908
Molecular FormulaC9H14N2O2S
Molecular Weight214.29 g/mol
Exact Mass214.08
IUPAC Name2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid
SMILESCCNCCc1nc(CC(=O)O)cs1
InChIInChI=1S/C9H14N2O2S/c1-2-10-4-3-8-11-7(6-14-8)5-9(12)13/h6,10H,2-5H2,1H3,(H,12,13)
InChIKeyKEICHGZQNYTVFL-UHFFFAOYSA-N
XLogP0.92
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.29
LogP ≤ 50.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid (CID 94256908) is 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid is CCNCCc1nc(CC(=O)O)cs1.
What is the InChIKey of 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is KEICHGZQNYTVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-2-10-4-3-8-11-7(6-14-8)5-9(12)13/h6,10H,2-5H2,1H3,(H,12,13).
What are the key properties of 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid?
2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 214.29 g/mol, XLogP of 0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(ethylamino)ethyl]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 94256908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).