C10H15NO2S — CID 63892978
2-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 63892978) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 63892978 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2-[2-(2,2-dimethylpropyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CC(C)(C)Cc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C10H15NO2S/c1-10(2,3)5-8-11-7(6-14-8)4-9(12)13/h6H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | RFQUYSJXQDJKGI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |