C9H13NO2S2 — CID 65129995
2-[2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 65129995) has the molecular formula C9H13NO2S2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-[2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 65129995 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-[2-(propylsulfanylmethyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCSCc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C9H13NO2S2/c1-2-3-13-6-8-10-7(5-14-8)4-9(11)12/h5H,2-4,6H2,1H3,(H,11,12) |
| InChIKey | ZRNVQYYXXHSJRM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|