About 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid
2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid (PubChem CID 60929744) has the molecular formula C10H16N2O2S2
and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid.
Molecular Properties
| Compound Name | 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid |
| PubChem CID | 60929744 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid |
| SMILES | CCc1nc(CSCCC(N)C(=O)O)cs1 |
| InChI | InChI=1S/C10H16N2O2S2/c1-2-9-12-7(6-16-9)5-15-4-3-8(11)10(13)14/h6,8H,2-5,11H2,1H3,(H,13,14) |
| InChIKey | JEEOXXYALMGKIV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid?
The IUPAC name of 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid (CID 60929744) is 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid.
What is the SMILES notation for 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid?
The canonical SMILES for 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid is CCc1nc(CSCCC(N)C(=O)O)cs1.
What is the InChIKey of 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid?
The InChIKey is JEEOXXYALMGKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2S2/c1-2-9-12-7(6-16-9)5-15-4-3-8(11)10(13)14/h6,8H,2-5,11H2,1H3,(H,13,14).
What are the key properties of 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid?
2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid has a molecular weight of 260.38 g/mol, XLogP of 1.74, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]butanoic acid is sourced from PubChem (CID 60929744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).