C9H15N3O3S — CID 60929999
2-amino-4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]butanoic acid (PubChem CID 60929999) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-amino-4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 60929999 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-amino-4-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]butanoic acid |
| SMILES | CCc1nnc(CSCCC(N)C(=O)O)o1 |
| InChI | InChI=1S/C9H15N3O3S/c1-2-7-11-12-8(15-7)5-16-4-3-6(10)9(13)14/h6H,2-5,10H2,1H3,(H,13,14) |
| InChIKey | CMCDNIJYCGSKQS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|