C8H12N2O3S — CID 60929875
2-amino-4-(1,2-oxazol-5-ylmethylsulfanyl)butanoic acid (PubChem CID 60929875) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-amino-4-(1,2-oxazol-5-ylmethylsulfanyl)butanoic acid.
| Compound Name | 2-amino-4-(1,2-oxazol-5-ylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 60929875 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-amino-4-(1,2-oxazol-5-ylmethylsulfanyl)butanoic acid |
| SMILES | NC(CCSCc1ccno1)C(=O)O |
| InChI | InChI=1S/C8H12N2O3S/c9-7(8(11)12)2-4-14-5-6-1-3-10-13-6/h1,3,7H,2,4-5,9H2,(H,11,12) |
| InChIKey | PRRABSWKXVHMFX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|