C11H14FNO2S — CID 57255612
(2S)-2-amino-4-[(2-fluorophenyl)methylsulfanyl]butanoic acid (PubChem CID 57255612) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is (2S)-2-amino-4-[(2-fluorophenyl)methylsulfanyl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[(2-fluorophenyl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 57255612 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2S)-2-amino-4-[(2-fluorophenyl)methylsulfanyl]butanoic acid |
| SMILES | N[C@@H](CCSCc1ccccc1F)C(=O)O |
| InChI | InChI=1S/C11H14FNO2S/c12-9-4-2-1-3-8(9)7-16-6-5-10(13)11(14)15/h1-4,10H,5-7,13H2,(H,14,15)/t10-/m0/s1 |
| InChIKey | BEXOVMSNFHMWIF-JTQLQIEISA-N |
| XLogP | 1.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|