C15H22FNO2S — CID 170770577
2-amino-4-[3-(2-fluorophenyl)-3-methylbutyl]sulfanylbutanoic acid (PubChem CID 170770577) has the molecular formula C15H22FNO2S and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-amino-4-[3-(2-fluorophenyl)-3-methylbutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-(2-fluorophenyl)-3-methylbutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770577 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-amino-4-[3-(2-fluorophenyl)-3-methylbutyl]sulfanylbutanoic acid |
| SMILES | CC(C)(CCSCCC(N)C(=O)O)c1ccccc1F |
| InChI | InChI=1S/C15H22FNO2S/c1-15(2,11-5-3-4-6-12(11)16)8-10-20-9-7-13(17)14(18)19/h3-6,13H,7-10,17H2,1-2H3,(H,18,19) |
| InChIKey | LZLYUXIWRKZMMN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|