C20H22F3NO4S — CID 170770671
2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-phenoxyphenyl)butyl]sulfanylbutanoic acid (PubChem CID 170770671) has the molecular formula C20H22F3NO4S and a molecular weight of 429.46 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-phenoxyphenyl)butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-phenoxyphenyl)butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770671 |
| Molecular Formula | C20H22F3NO4S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-phenoxyphenyl)butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1ccc(Oc2ccccc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H22F3NO4S/c21-20(22,23)19(27,11-13-29-12-10-17(24)18(25)26)14-6-8-16(9-7-14)28-15-4-2-1-3-5-15/h1-9,17,27H,10-13,24H2,(H,25,26) |
| InChIKey | WJWWJALWYPUFHU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|