C15H18F3N3O3S — CID 170769976
2-amino-4-[3-(1H-benzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid (PubChem CID 170769976) has the molecular formula C15H18F3N3O3S and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-amino-4-[3-(1H-benzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-(1H-benzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769976 |
| Molecular Formula | C15H18F3N3O3S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-amino-4-[3-(1H-benzimidazol-2-yl)-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1nc2ccccc2[nH]1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H18F3N3O3S/c16-15(17,18)14(24,6-8-25-7-5-9(19)12(22)23)13-20-10-3-1-2-4-11(10)21-13/h1-4,9,24H,5-8,19H2,(H,20,21)(H,22,23) |
| InChIKey | CUPSFBDVZBPRSV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|