C19H21F3N2O4S — CID 170769990
2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(5-phenoxy-2-pyridinyl)butyl]sulfanylbutanoic acid (PubChem CID 170769990) has the molecular formula C19H21F3N2O4S and a molecular weight of 430.45 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(5-phenoxy-2-pyridinyl)butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(5-phenoxy-2-pyridinyl)butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769990 |
| Molecular Formula | C19H21F3N2O4S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(5-phenoxy-2-pyridinyl)butyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1ccc(Oc2ccccc2)cn1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C19H21F3N2O4S/c20-19(21,22)18(27,9-11-29-10-8-15(23)17(25)26)16-7-6-14(12-24-16)28-13-4-2-1-3-5-13/h1-7,12,15,27H,8-11,23H2,(H,25,26) |
| InChIKey | GNOWBMCUDAIHPQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|