C20H21ClF3NO3S — CID 170770535
2-amino-4-[3-[4-(4-chlorophenyl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid (PubChem CID 170770535) has the molecular formula C20H21ClF3NO3S and a molecular weight of 447.91 g/mol. Its IUPAC name is 2-amino-4-[3-[4-(4-chlorophenyl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[3-[4-(4-chlorophenyl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770535 |
| Molecular Formula | C20H21ClF3NO3S |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-amino-4-[3-[4-(4-chlorophenyl)phenyl]-4,4,4-trifluoro-3-hydroxybutyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1ccc(-c2ccc(Cl)cc2)cc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H21ClF3NO3S/c21-16-7-3-14(4-8-16)13-1-5-15(6-2-13)19(28,20(22,23)24)10-12-29-11-9-17(25)18(26)27/h1-8,17,28H,9-12,25H2,(H,26,27) |
| InChIKey | FPFVSGHKISJVQC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|