C12H15F2NO2S — CID 170770426
2-amino-4-[2-(3,4-difluorophenyl)ethylsulfanyl]butanoic acid (PubChem CID 170770426) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-amino-4-[2-(3,4-difluorophenyl)ethylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[2-(3,4-difluorophenyl)ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 170770426 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-amino-4-[2-(3,4-difluorophenyl)ethylsulfanyl]butanoic acid |
| SMILES | NC(CCSCCc1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C12H15F2NO2S/c13-9-2-1-8(7-10(9)14)3-5-18-6-4-11(15)12(16)17/h1-2,7,11H,3-6,15H2,(H,16,17) |
| InChIKey | HYHZRVRIGMDHSI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|