C11H22N2O4S2 — CID 110192936
2-amino-4-[3-(3-amino-3-carboxypropyl)sulfanylpropylsulfanyl]butanoic acid (PubChem CID 110192936) has the molecular formula C11H22N2O4S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-amino-4-[3-(3-amino-3-carboxypropyl)sulfanylpropylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[3-(3-amino-3-carboxypropyl)sulfanylpropylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 110192936 |
| Molecular Formula | C11H22N2O4S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-amino-4-[3-(3-amino-3-carboxypropyl)sulfanylpropylsulfanyl]butanoic acid |
| SMILES | NC(CCSCCCSCCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H22N2O4S2/c12-8(10(14)15)2-6-18-4-1-5-19-7-3-9(13)11(16)17/h8-9H,1-7,12-13H2,(H,14,15)(H,16,17) |
| InChIKey | QYLRZOWOOBKEQF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|