C9H19NO2S2 — CID 134211967
(2S)-2-amino-4-(2-propan-2-ylsulfanylethylsulfanyl)butanoic acid (PubChem CID 134211967) has the molecular formula C9H19NO2S2 and a molecular weight of 237.39 g/mol. Its IUPAC name is (2S)-2-amino-4-(2-propan-2-ylsulfanylethylsulfanyl)butanoic acid.
| Compound Name | (2S)-2-amino-4-(2-propan-2-ylsulfanylethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 134211967 |
| Molecular Formula | C9H19NO2S2 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (2S)-2-amino-4-(2-propan-2-ylsulfanylethylsulfanyl)butanoic acid |
| SMILES | CC(C)SCCSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H19NO2S2/c1-7(2)14-6-5-13-4-3-8(10)9(11)12/h7-8H,3-6,10H2,1-2H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | VMHHJLUREAHXRO-QMMMGPOBSA-N |
| XLogP | 1.66 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|