C9H17NO2S — CID 114472697
2-amino-4-(3-methylbut-3-enylsulfanyl)butanoic acid (PubChem CID 114472697) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 2-amino-4-(3-methylbut-3-enylsulfanyl)butanoic acid.
| Compound Name | 2-amino-4-(3-methylbut-3-enylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 114472697 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 2-amino-4-(3-methylbut-3-enylsulfanyl)butanoic acid |
| SMILES | C=C(C)CCSCCC(N)C(=O)O |
| InChI | InChI=1S/C9H17NO2S/c1-7(2)3-5-13-6-4-8(10)9(11)12/h8H,1,3-6,10H2,2H3,(H,11,12) |
| InChIKey | YXQDLNDWARGLRV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|