C9H18N2O3S — CID 175865110
(2R)-2-amino-4-methylsulfanylbutanoic acid;2-methylprop-2-enamide (PubChem CID 175865110) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is (2R)-2-amino-4-methylsulfanylbutanoic acid;2-methylprop-2-enamide.
| Compound Name | (2R)-2-amino-4-methylsulfanylbutanoic acid;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 175865110 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2R)-2-amino-4-methylsulfanylbutanoic acid;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.CSCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S.C4H7NO/c1-9-3-2-4(6)5(7)8;1-3(2)4(5)6/h4H,2-3,6H2,1H3,(H,7,8);1H2,2H3,(H2,5,6)/t4-;/m1./s1 |
| InChIKey | HYLAJDHCBKCWMU-PGMHMLKASA-N |
| XLogP | 0.20 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|