C8H15NO4S2 — CID 11622975
2-amino-4-[2-(carboxymethylsulfanyl)ethylsulfanyl]butanoic acid (PubChem CID 11622975) has the molecular formula C8H15NO4S2 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-amino-4-[2-(carboxymethylsulfanyl)ethylsulfanyl]butanoic acid.
| Compound Name | 2-amino-4-[2-(carboxymethylsulfanyl)ethylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 11622975 |
| Molecular Formula | C8H15NO4S2 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-amino-4-[2-(carboxymethylsulfanyl)ethylsulfanyl]butanoic acid |
| SMILES | NC(CCSCCSCC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H15NO4S2/c9-6(8(12)13)1-2-14-3-4-15-5-7(10)11/h6H,1-5,9H2,(H,10,11)(H,12,13) |
| InChIKey | GLHASHYRALJEQT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|