C10H23N3O6S — CID 87886710
bis(2-aminoacetic acid);(2S)-2-amino-4-ethylsulfanylbutanoic acid (PubChem CID 87886710) has the molecular formula C10H23N3O6S and a molecular weight of 313.38 g/mol. Its IUPAC name is bis(2-aminoacetic acid);(2S)-2-amino-4-ethylsulfanylbutanoic acid.
| Compound Name | bis(2-aminoacetic acid);(2S)-2-amino-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 87886710 |
| Molecular Formula | C10H23N3O6S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | bis(2-aminoacetic acid);(2S)-2-amino-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCC[C@H](N)C(=O)O.NCC(=O)O.NCC(=O)O |
| InChI | InChI=1S/C6H13NO2S.2C2H5NO2/c1-2-10-4-3-5(7)6(8)9;2*3-1-2(4)5/h5H,2-4,7H2,1H3,(H,8,9);2*1,3H2,(H,4,5)/t5-;;/m0../s1 |
| InChIKey | SSLGWDUFLMRDDH-XRIGFGBMSA-N |
| XLogP | -1.40 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|