C7H12O4S — CID 87754532
2-(2-ethylsulfanylethyl)propanedioic acid (PubChem CID 87754532) has the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(2-ethylsulfanylethyl)propanedioic acid.
| Compound Name | 2-(2-ethylsulfanylethyl)propanedioic acid |
|---|---|
| PubChem CID | 87754532 |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-(2-ethylsulfanylethyl)propanedioic acid |
| SMILES | CCSCCC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12O4S/c1-2-12-4-3-5(6(8)9)7(10)11/h5H,2-4H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | AIWWSVRBVVOLEP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|