C6H12ClNO2S — CID 150236814
(2S)-2-(chloroamino)-4-ethylsulfanylbutanoic acid (PubChem CID 150236814) has the molecular formula C6H12ClNO2S and a molecular weight of 197.69 g/mol. Its IUPAC name is (2S)-2-(chloroamino)-4-ethylsulfanylbutanoic acid.
| Compound Name | (2S)-2-(chloroamino)-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 150236814 |
| Molecular Formula | C6H12ClNO2S |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | (2S)-2-(chloroamino)-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCC[C@H](NCl)C(=O)O |
| InChI | InChI=1S/C6H12ClNO2S/c1-2-11-4-3-5(8-7)6(9)10/h5,8H,2-4H2,1H3,(H,9,10)/t5-/m0/s1 |
| InChIKey | FWRMXMVSZQVUIA-YFKPBYRVSA-N |
| XLogP | 1.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|