C13H17ClN2O3S — CID 108783530
2-[(3-chlorophenyl)carbamoylamino]-4-ethylsulfanylbutanoic acid (PubChem CID 108783530) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)carbamoylamino]-4-ethylsulfanylbutanoic acid.
| Compound Name | 2-[(3-chlorophenyl)carbamoylamino]-4-ethylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108783530 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[(3-chlorophenyl)carbamoylamino]-4-ethylsulfanylbutanoic acid |
| SMILES | CCSCCC(NC(=O)Nc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H17ClN2O3S/c1-2-20-7-6-11(12(17)18)16-13(19)15-10-5-3-4-9(14)8-10/h3-5,8,11H,2,6-7H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | JMQGQRKPCUBVIL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|